C10H16BrNO3S2 — CID 55137039
N-[(4-bromothiophen-2-yl)methyl]-2-ethoxy-N-methylethanesulfonamide (PubChem CID 55137039) has the molecular formula C10H16BrNO3S2 and a molecular weight of 342.28 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-ethoxy-N-methylethanesulfonamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-ethoxy-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 55137039 |
| Molecular Formula | C10H16BrNO3S2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-ethoxy-N-methylethanesulfonamide |
| SMILES | CCOCCS(=O)(=O)N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C10H16BrNO3S2/c1-3-15-4-5-17(13,14)12(2)7-10-6-9(11)8-16-10/h6,8H,3-5,7H2,1-2H3 |
| InChIKey | KPILMYWDCTUNPG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|