C12H10Br2FNO2S2 — CID 103697383
4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzenesulfonamide (PubChem CID 103697383) has the molecular formula C12H10Br2FNO2S2 and a molecular weight of 443.16 g/mol. Its IUPAC name is 4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103697383 |
| Molecular Formula | C12H10Br2FNO2S2 |
| Molecular Weight | 443.16 g/mol |
| Exact Mass | 440.85 |
| IUPAC Name | 4-bromo-N-[(4-bromothiophen-2-yl)methyl]-3-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1cc(Br)cs1)S(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H10Br2FNO2S2/c1-16(6-9-4-8(13)7-19-9)20(17,18)10-2-3-11(14)12(15)5-10/h2-5,7H,6H2,1H3 |
| InChIKey | RPZNUIZXCHVOLW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.16 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |