C12H11BrFNO2S2 — CID 113242535
4-bromo-3-fluoro-N-methyl-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 113242535) has the molecular formula C12H11BrFNO2S2 and a molecular weight of 364.26 g/mol. Its IUPAC name is 4-bromo-3-fluoro-N-methyl-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-3-fluoro-N-methyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113242535 |
| Molecular Formula | C12H11BrFNO2S2 |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 4-bromo-3-fluoro-N-methyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CN(Cc1cccs1)S(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H11BrFNO2S2/c1-15(8-9-3-2-6-18-9)19(16,17)10-4-5-11(13)12(14)7-10/h2-7H,8H2,1H3 |
| InChIKey | QVLSCJJZZFUOHY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |