C14H12Br2FNO2S — CID 103697185
4-bromo-N-[(4-bromophenyl)methyl]-3-fluoro-N-methylbenzenesulfonamide (PubChem CID 103697185) has the molecular formula C14H12Br2FNO2S and a molecular weight of 437.13 g/mol. Its IUPAC name is 4-bromo-N-[(4-bromophenyl)methyl]-3-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-N-[(4-bromophenyl)methyl]-3-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103697185 |
| Molecular Formula | C14H12Br2FNO2S |
| Molecular Weight | 437.13 g/mol |
| Exact Mass | 434.89 |
| IUPAC Name | 4-bromo-N-[(4-bromophenyl)methyl]-3-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(Cc1ccc(Br)cc1)S(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C14H12Br2FNO2S/c1-18(9-10-2-4-11(15)5-3-10)21(19,20)12-6-7-13(16)14(17)8-12/h2-8H,9H2,1H3 |
| InChIKey | XCSJXMNKHFQLDZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.13 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |