C57H51IrN4- — CID 166502162
2,4-bis(4-tert-butylphenyl)-6-[6-(7-butylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium (PubChem CID 166502162) has the molecular formula C57H51IrN4- and a molecular weight of 984.28 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[6-(7-butylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[6-(7-butylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium |
|---|---|
| PubChem CID | 166502162 |
| Molecular Formula | C57H51IrN4- |
| Molecular Weight | 984.28 g/mol |
| Exact Mass | 984.37 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[6-(7-butylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium |
| SMILES | CCCCc1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1cc(-c3ccc(-c4nc(-c5ccc(C(C)(C)C)cc5)nc(-c5ccc(C(C)(C)C)cc5)n4)cn3)[c-]cc1-2.[Ir] |
| InChI | InChI=1S/C57H51N4.Ir/c1-8-9-14-36-19-30-45-46-31-24-39(34-50(46)57(49(45)33-36)47-17-12-10-15-43(47)44-16-11-13-18-48(44)57)51-32-25-40(35-58-51)54-60-52(37-20-26-41(27-21-37)55(2,3)4)59-53(61-54)38-22-28-42(29-23-38)56(5,6)7;/h10-13,15-23,25-35H,8-9,14H2,1-7H3;/q-1; |
| InChIKey | LCRVDZWGJJQFHH-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.28 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|