C48H49IrN4- — CID 166571242
2,4-ditert-butyl-6-[6-(2'-heptylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium (PubChem CID 166571242) has the molecular formula C48H49IrN4- and a molecular weight of 874.16 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[6-(2'-heptylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium.
| Compound Name | 2,4-ditert-butyl-6-[6-(2'-heptylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium |
|---|---|
| PubChem CID | 166571242 |
| Molecular Formula | C48H49IrN4- |
| Molecular Weight | 874.16 g/mol |
| Exact Mass | 874.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[6-(2'-heptylspiro[3H-fluoren-3-ide-9,9'-fluorene]-2-yl)-3-pyridinyl]-1,3,5-triazine;iridium |
| SMILES | CCCCCCCc1ccc2c(c1)C1(c3ccccc3-c3c[c-]c(-c4ccc(-c5nc(C(C)(C)C)nc(C(C)(C)C)n5)cn4)cc31)c1ccccc1-2.[Ir] |
| InChI | InChI=1S/C48H49N4.Ir/c1-8-9-10-11-12-17-31-22-25-36-34-18-13-15-20-38(34)48(40(36)28-31)39-21-16-14-19-35(39)37-26-23-32(29-41(37)48)42-27-24-33(30-49-42)43-50-44(46(2,3)4)52-45(51-43)47(5,6)7;/h13-16,18-22,24-30H,8-12,17H2,1-7H3;/q-1; |
| InChIKey | GKEKNZAWSNIAOD-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.16 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|