C61H56N4 — CID 166571189
2-tert-butyl-4-[6-(9,9-dimethyl-7-naphthalen-2-ylfluoren-2-yl)-3-pyridinyl]-6-[3-[3-(6-phenylhexyl)phenyl]phenyl]-1,3,5-triazine (PubChem CID 166571189) has the molecular formula C61H56N4 and a molecular weight of 845.15 g/mol. Its IUPAC name is 2-tert-butyl-4-[6-(9,9-dimethyl-7-naphthalen-2-ylfluoren-2-yl)-3-pyridinyl]-6-[3-[3-(6-phenylhexyl)phenyl]phenyl]-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-[6-(9,9-dimethyl-7-naphthalen-2-ylfluoren-2-yl)-3-pyridinyl]-6-[3-[3-(6-phenylhexyl)phenyl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166571189 |
| Molecular Formula | C61H56N4 |
| Molecular Weight | 845.15 g/mol |
| Exact Mass | 844.45 |
| IUPAC Name | 2-tert-butyl-4-[6-(9,9-dimethyl-7-naphthalen-2-ylfluoren-2-yl)-3-pyridinyl]-6-[3-[3-(6-phenylhexyl)phenyl]phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1nc(-c2ccc(-c3ccc4c(c3)C(C)(C)c3cc(-c5ccc6ccccc6c5)ccc3-4)nc2)nc(-c2cccc(-c3cccc(CCCCCCc4ccccc4)c3)c2)n1 |
| InChI | InChI=1S/C61H56N4/c1-60(2,3)59-64-57(50-26-16-25-46(37-50)44-24-15-21-42(35-44)20-10-7-6-9-17-41-18-11-8-12-19-41)63-58(65-59)51-31-34-56(62-40-51)49-30-33-53-52-32-29-48(38-54(52)61(4,5)55(53)39-49)47-28-27-43-22-13-14-23-45(43)36-47/h8,11-16,18-19,21-40H,6-7,9-10,17,20H2,1-5H3 |
| InChIKey | ONRYGLWWXZRDCT-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.15 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|