C50H46IrN- — CID 162471402
2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-6-(3-octylphenyl)-4-(2-phenylphenyl)quinoline;iridium (PubChem CID 162471402) has the molecular formula C50H46IrN- and a molecular weight of 853.14 g/mol. Its IUPAC name is 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-6-(3-octylphenyl)-4-(2-phenylphenyl)quinoline;iridium.
| Compound Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-6-(3-octylphenyl)-4-(2-phenylphenyl)quinoline;iridium |
|---|---|
| PubChem CID | 162471402 |
| Molecular Formula | C50H46IrN- |
| Molecular Weight | 853.14 g/mol |
| Exact Mass | 853.33 |
| IUPAC Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-6-(3-octylphenyl)-4-(2-phenylphenyl)quinoline;iridium |
| SMILES | CCCCCCCCc1cccc(-c2ccc3nc(-c4[c-]cc5c(c4)C(C)(C)c4ccccc4-5)cc(-c4ccccc4-c4ccccc4)c3c2)c1.[Ir] |
| InChI | InChI=1S/C50H46N.Ir/c1-4-5-6-7-8-10-18-35-19-17-22-37(31-35)38-28-30-48-45(32-38)44(41-24-14-13-23-40(41)36-20-11-9-12-21-36)34-49(51-48)39-27-29-43-42-25-15-16-26-46(42)50(2,3)47(43)33-39;/h9,11-17,19-26,28-34H,4-8,10,18H2,1-3H3;/q-1; |
| InChIKey | WYKABXCVCSVPSP-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.14 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|