C53H43IrN3-2 — CID 159163570
2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium;phenyl-[(Z)-4-phenyliminopent-2-en-2-yl]azanide (PubChem CID 159163570) has the molecular formula C53H43IrN3-2 and a molecular weight of 914.17 g/mol. Its IUPAC name is 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium;phenyl-[(Z)-4-phenyliminopent-2-en-2-yl]azanide.
| Compound Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium;phenyl-[(Z)-4-phenyliminopent-2-en-2-yl]azanide |
|---|---|
| PubChem CID | 159163570 |
| Molecular Formula | C53H43IrN3-2 |
| Molecular Weight | 914.17 g/mol |
| Exact Mass | 914.31 |
| IUPAC Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium;phenyl-[(Z)-4-phenyliminopent-2-en-2-yl]azanide |
| SMILES | C/C(=C/C(C)=N\c1ccccc1)[N-]c1ccccc1.CC1(C)c2ccccc2-c2c[c-]c(-c3cc(-c4ccccc4)c4cc(-c5ccccc5)ccc4n3)cc21.[Ir] |
| InChI | InChI=1S/C36H26N.C17H17N2.Ir/c1-36(2)32-16-10-9-15-28(32)29-19-17-27(22-33(29)36)35-23-30(25-13-7-4-8-14-25)31-21-26(18-20-34(31)37-35)24-11-5-3-6-12-24;1-14(18-16-9-5-3-6-10-16)13-15(2)19-17-11-7-4-8-12-17;/h3-16,18-23H,1-2H3;3-13H,1-2H3;/q2*-1;/b;14-13-,19-15-; |
| InChIKey | CGUOPXOPLKFOKF-VGFPTDOFSA-N |
| XLogP | 14.73 |
| TPSA | 39.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.17 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|