C61H58IrNO2- — CID 162471357
2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-phenyl-6-[2-[3-(6-phenylhexyl)phenyl]phenyl]quinoline;(Z)-5-hydroxyhept-4-en-3-one;iridium (PubChem CID 162471357) has the molecular formula C61H58IrNO2- and a molecular weight of 1029.36 g/mol. Its IUPAC name is 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-phenyl-6-[2-[3-(6-phenylhexyl)phenyl]phenyl]quinoline;(Z)-5-hydroxyhept-4-en-3-one;iridium.
| Compound Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-phenyl-6-[2-[3-(6-phenylhexyl)phenyl]phenyl]quinoline;(Z)-5-hydroxyhept-4-en-3-one;iridium |
|---|---|
| PubChem CID | 162471357 |
| Molecular Formula | C61H58IrNO2- |
| Molecular Weight | 1029.36 g/mol |
| Exact Mass | 1029.41 |
| IUPAC Name | 2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4-phenyl-6-[2-[3-(6-phenylhexyl)phenyl]phenyl]quinoline;(Z)-5-hydroxyhept-4-en-3-one;iridium |
| SMILES | CC1(C)c2ccccc2-c2c[c-]c(-c3cc(-c4ccccc4)c4cc(-c5ccccc5-c5cccc(CCCCCCc6ccccc6)c5)ccc4n3)cc21.CCC(=O)/C=C(\O)CC.[Ir] |
| InChI | InChI=1S/C54H46N.C7H12O2.Ir/c1-54(2)50-29-16-15-28-46(50)47-32-30-43(36-51(47)54)53-37-48(40-23-11-6-12-24-40)49-35-42(31-33-52(49)55-53)45-27-14-13-26-44(45)41-25-17-22-39(34-41)21-8-4-3-7-18-38-19-9-5-10-20-38;1-3-6(8)5-7(9)4-2;/h5-6,9-17,19-20,22-29,31-37H,3-4,7-8,18,21H2,1-2H3;5,8H,3-4H2,1-2H3;/q-1;;/b;6-5-; |
| InChIKey | CGJXLXUKPCJPQS-XRPAZMCKSA-N |
| XLogP | 16.17 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.36 |
| LogP ≤ 5 | 16.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|