C40H35IrN3-2 — CID 162471408
(C,N-dimethylcarbonimidoyl)-methylazanide;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium (PubChem CID 162471408) has the molecular formula C40H35IrN3-2 and a molecular weight of 749.96 g/mol. Its IUPAC name is (C,N-dimethylcarbonimidoyl)-methylazanide;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium.
| Compound Name | (C,N-dimethylcarbonimidoyl)-methylazanide;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium |
|---|---|
| PubChem CID | 162471408 |
| Molecular Formula | C40H35IrN3-2 |
| Molecular Weight | 749.96 g/mol |
| Exact Mass | 750.25 |
| IUPAC Name | (C,N-dimethylcarbonimidoyl)-methylazanide;2-(9,9-dimethyl-3H-fluoren-3-id-2-yl)-4,6-diphenylquinoline;iridium |
| SMILES | C/N=C(\C)[N-]C.CC1(C)c2ccccc2-c2c[c-]c(-c3cc(-c4ccccc4)c4cc(-c5ccccc5)ccc4n3)cc21.[Ir] |
| InChI | InChI=1S/C36H26N.C4H9N2.Ir/c1-36(2)32-16-10-9-15-28(32)29-19-17-27(22-33(29)36)35-23-30(25-13-7-4-8-14-25)31-21-26(18-20-34(31)37-35)24-11-5-3-6-12-24;1-4(5-2)6-3;/h3-16,18-23H,1-2H3;1-3H3;/q2*-1; |
| InChIKey | RPYNRUTZVGEOLP-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 39.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.96 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|