C47H64N4 — CID 166571253
2-tert-butyl-4-cyclohexyl-6-[6-(9,9-dioctylfluoren-2-yl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 166571253) has the molecular formula C47H64N4 and a molecular weight of 685.06 g/mol. Its IUPAC name is 2-tert-butyl-4-cyclohexyl-6-[6-(9,9-dioctylfluoren-2-yl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2-tert-butyl-4-cyclohexyl-6-[6-(9,9-dioctylfluoren-2-yl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166571253 |
| Molecular Formula | C47H64N4 |
| Molecular Weight | 685.06 g/mol |
| Exact Mass | 684.51 |
| IUPAC Name | 2-tert-butyl-4-cyclohexyl-6-[6-(9,9-dioctylfluoren-2-yl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(-c3ccc(-c4nc(C5CCCCC5)nc(C(C)(C)C)n4)cn3)cc21 |
| InChI | InChI=1S/C47H64N4/c1-6-8-10-12-14-21-31-47(32-22-15-13-11-9-7-2)40-26-20-19-25-38(40)39-29-27-36(33-41(39)47)42-30-28-37(34-48-42)44-49-43(35-23-17-16-18-24-35)50-45(51-44)46(3,4)5/h19-20,25-30,33-35H,6-18,21-24,31-32H2,1-5H3 |
| InChIKey | XGSDENMPYXLIOH-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.06 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|