C51H59IrN4- — CID 166571149
2-tert-butyl-4-[6-(9,9-dioctyl-3H-fluoren-3-id-2-yl)-3-pyridinyl]-6-naphthalen-1-yl-1,3,5-triazine;iridium (PubChem CID 166571149) has the molecular formula C51H59IrN4- and a molecular weight of 920.28 g/mol. Its IUPAC name is 2-tert-butyl-4-[6-(9,9-dioctyl-3H-fluoren-3-id-2-yl)-3-pyridinyl]-6-naphthalen-1-yl-1,3,5-triazine;iridium.
| Compound Name | 2-tert-butyl-4-[6-(9,9-dioctyl-3H-fluoren-3-id-2-yl)-3-pyridinyl]-6-naphthalen-1-yl-1,3,5-triazine;iridium |
|---|---|
| PubChem CID | 166571149 |
| Molecular Formula | C51H59IrN4- |
| Molecular Weight | 920.28 g/mol |
| Exact Mass | 920.44 |
| IUPAC Name | 2-tert-butyl-4-[6-(9,9-dioctyl-3H-fluoren-3-id-2-yl)-3-pyridinyl]-6-naphthalen-1-yl-1,3,5-triazine;iridium |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2c[c-]c(-c3ccc(-c4nc(-c5cccc6ccccc56)nc(C(C)(C)C)n4)cn3)cc21.[Ir] |
| InChI | InChI=1S/C51H59N4.Ir/c1-6-8-10-12-14-20-33-51(34-21-15-13-11-9-7-2)44-28-19-18-26-41(44)42-31-29-38(35-45(42)51)46-32-30-39(36-52-46)47-53-48(55-49(54-47)50(3,4)5)43-27-22-24-37-23-16-17-25-40(37)43;/h16-19,22-28,30-32,35-36H,6-15,20-21,33-34H2,1-5H3;/q-1; |
| InChIKey | UVXFHEYSLZOTAZ-UHFFFAOYSA-N |
| XLogP | 14.28 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.28 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|