C50H61N — CID 102582736
4-(3,5-ditert-butylphenyl)-2-(9,9-dihexylfluoren-2-yl)-6-phenylpyridine (PubChem CID 102582736) has the molecular formula C50H61N and a molecular weight of 676.05 g/mol. Its IUPAC name is 4-(3,5-ditert-butylphenyl)-2-(9,9-dihexylfluoren-2-yl)-6-phenylpyridine.
| Compound Name | 4-(3,5-ditert-butylphenyl)-2-(9,9-dihexylfluoren-2-yl)-6-phenylpyridine |
|---|---|
| PubChem CID | 102582736 |
| Molecular Formula | C50H61N |
| Molecular Weight | 676.05 g/mol |
| Exact Mass | 675.48 |
| IUPAC Name | 4-(3,5-ditert-butylphenyl)-2-(9,9-dihexylfluoren-2-yl)-6-phenylpyridine |
| SMILES | CCCCCCC1(CCCCCC)c2ccccc2-c2ccc(-c3cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)cc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C50H61N/c1-9-11-13-20-28-50(29-21-14-12-10-2)44-25-19-18-24-42(44)43-27-26-37(32-45(43)50)47-34-39(33-46(51-47)36-22-16-15-17-23-36)38-30-40(48(3,4)5)35-41(31-38)49(6,7)8/h15-19,22-27,30-35H,9-14,20-21,28-29H2,1-8H3 |
| InChIKey | WOGWOIGHZQFWMP-UHFFFAOYSA-N |
| XLogP | 14.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.05 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|