C60H68N4 — CID 140808907
2,4-bis(4-tert-butylphenyl)-6-[6-[9-(3,5-dihexylphenyl)-9,10-dihydrophenanthren-2-yl]-3-pyridinyl]-1,3,5-triazine (PubChem CID 140808907) has the molecular formula C60H68N4 and a molecular weight of 845.23 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[6-[9-(3,5-dihexylphenyl)-9,10-dihydrophenanthren-2-yl]-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[6-[9-(3,5-dihexylphenyl)-9,10-dihydrophenanthren-2-yl]-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140808907 |
| Molecular Formula | C60H68N4 |
| Molecular Weight | 845.23 g/mol |
| Exact Mass | 844.54 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[6-[9-(3,5-dihexylphenyl)-9,10-dihydrophenanthren-2-yl]-3-pyridinyl]-1,3,5-triazine |
| SMILES | CCCCCCc1cc(CCCCCC)cc(C2Cc3cc(-c4ccc(-c5nc(-c6ccc(C(C)(C)C)cc6)nc(-c6ccc(C(C)(C)C)cc6)n5)cn4)ccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C60H68N4/c1-9-11-13-15-19-41-35-42(20-16-14-12-10-2)37-47(36-41)54-39-48-38-45(27-33-51(48)52-21-17-18-22-53(52)54)55-34-28-46(40-61-55)58-63-56(43-23-29-49(30-24-43)59(3,4)5)62-57(64-58)44-25-31-50(32-26-44)60(6,7)8/h17-18,21-38,40,54H,9-16,19-20,39H2,1-8H3 |
| InChIKey | HMTNHUKMCKMTOQ-UHFFFAOYSA-N |
| XLogP | 16.13 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.23 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|