C47H35BrO2 — CID 58175381
7-bromo-10,10-dimethyl-14,21-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol (PubChem CID 58175381) has the molecular formula C47H35BrO2 and a molecular weight of 711.70 g/mol. Its IUPAC name is 7-bromo-10,10-dimethyl-14,21-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol.
| Compound Name | 7-bromo-10,10-dimethyl-14,21-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol |
|---|---|
| PubChem CID | 58175381 |
| Molecular Formula | C47H35BrO2 |
| Molecular Weight | 711.70 g/mol |
| Exact Mass | 710.18 |
| IUPAC Name | 7-bromo-10,10-dimethyl-14,21-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4(9),5,7,11,15,17,19-nonaene-14,21-diol |
| SMILES | CC1(C)c2cc(Br)ccc2-c2cc3c(cc21)C(O)(c1ccc(-c2ccccc2)cc1)c1ccccc1C3(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C47H35BrO2/c1-45(2)41-27-36(48)25-26-37(41)38-28-43-44(29-42(38)45)47(50,35-23-19-33(20-24-35)31-13-7-4-8-14-31)40-16-10-9-15-39(40)46(43,49)34-21-17-32(18-22-34)30-11-5-3-6-12-30/h3-29,49-50H,1-2H3 |
| InChIKey | KGBIYQUBYUMNFE-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.70 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |