C13H14F3NO — CID 171962539
3-(2,3,6-trifluorophenyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171962539) has the molecular formula C13H14F3NO and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-(2,3,6-trifluorophenyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2,3,6-trifluorophenyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171962539 |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 3-(2,3,6-trifluorophenyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2c(F)ccc(F)c2F)CC2CCC(C1)N2 |
| InChI | InChI=1S/C13H14F3NO/c14-9-3-4-10(15)12(16)11(9)13(18)5-7-1-2-8(6-13)17-7/h3-4,7-8,17-18H,1-2,5-6H2 |
| InChIKey | AICZVIBTBIZWPT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|