C16H19FO3S — CID 171947393
(3-fluoro-5-methoxyphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 171947393) has the molecular formula C16H19FO3S and a molecular weight of 310.39 g/mol. Its IUPAC name is (3-fluoro-5-methoxyphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone.
| Compound Name | (3-fluoro-5-methoxyphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
|---|---|
| PubChem CID | 171947393 |
| Molecular Formula | C16H19FO3S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (3-fluoro-5-methoxyphenyl)-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | COc1cc(F)cc(C(=O)C2CC3CCCC(C2)S3=O)c1 |
| InChI | InChI=1S/C16H19FO3S/c1-20-13-6-10(5-12(17)9-13)16(18)11-7-14-3-2-4-15(8-11)21(14)19/h5-6,9,11,14-15H,2-4,7-8H2,1H3 |
| InChIKey | VXPFXGDDYFKQKC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |