C15H15F3O2S — CID 171948326
(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(2,3,5-trifluorophenyl)methanone (PubChem CID 171948326) has the molecular formula C15H15F3O2S and a molecular weight of 316.34 g/mol. Its IUPAC name is (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(2,3,5-trifluorophenyl)methanone.
| Compound Name | (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(2,3,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 171948326 |
| Molecular Formula | C15H15F3O2S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-(2,3,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1F)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C15H15F3O2S/c16-9-6-12(14(18)13(17)7-9)15(19)8-4-10-2-1-3-11(5-8)21(10)20/h6-8,10-11H,1-5H2 |
| InChIKey | RQLSSGKVLKYDMX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|