C18H21NO2S — CID 171962731
1-[3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)phenyl]cyclopropane-1-carbonitrile (PubChem CID 171962731) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-[3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 171962731 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)phenyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2cccc(C3(O)CC4CCCC(C3)S4=O)c2)CC1 |
| InChI | InChI=1S/C18H21NO2S/c19-12-17(7-8-17)13-3-1-4-14(9-13)18(20)10-15-5-2-6-16(11-18)22(15)21/h1,3-4,9,15-16,20H,2,5-8,10-11H2 |
| InChIKey | BLXAAAIKRJXRER-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |