C16H19NO2S — CID 171960508
3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile (PubChem CID 171960508) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile.
| Compound Name | 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile |
|---|---|
| PubChem CID | 171960508 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1C1(O)CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C16H19NO2S/c1-11-5-6-12(10-17)7-15(11)16(18)8-13-3-2-4-14(9-16)20(13)19/h5-7,13-14,18H,2-4,8-9H2,1H3 |
| InChIKey | VTOHBSQXBUSJFR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |