About 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile
3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile (PubChem CID 171960508) has the molecular formula C16H19NO2S
and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile.
Molecular Properties
| Compound Name | 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile |
| PubChem CID | 171960508 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile |
| SMILES | Cc1ccc(C#N)cc1C1(O)CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C16H19NO2S/c1-11-5-6-12(10-17)7-15(11)16(18)8-13-3-2-4-14(9-16)20(13)19/h5-7,13-14,18H,2-4,8-9H2,1H3 |
| InChIKey | VTOHBSQXBUSJFR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile?
The IUPAC name of 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile (CID 171960508) is 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile.
What is the SMILES notation for 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile?
The canonical SMILES for 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile is Cc1ccc(C#N)cc1C1(O)CC2CCCC(C1)S2=O.
What is the InChIKey of 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile?
The InChIKey is VTOHBSQXBUSJFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-11-5-6-12(10-17)7-15(11)16(18)8-13-3-2-4-14(9-16)20(13)19/h5-7,13-14,18H,2-4,8-9H2,1H3.
What are the key properties of 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile?
3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile has a molecular weight of 289.40 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)-4-methylbenzonitrile is sourced from PubChem (CID 171960508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).