C14H16N2O2S — CID 171958154
6-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pyridine-3-carbonitrile (PubChem CID 171958154) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 6-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171958154 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 6-(3-hydroxy-9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C2(O)CC3CCCC(C2)S3=O)nc1 |
| InChI | InChI=1S/C14H16N2O2S/c15-8-10-4-5-13(16-9-10)14(17)6-11-2-1-3-12(7-14)19(11)18/h4-5,9,11-12,17H,1-3,6-7H2 |
| InChIKey | LSOCMYFSRUTAGW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |