C15H22NO5P — CID 132581718
(5S)-5-diethoxyphosphoryl-3-(phenylmethoxymethyl)-4,5-dihydro-1,2-oxazole (PubChem CID 132581718) has the molecular formula C15H22NO5P and a molecular weight of 327.32 g/mol. Its IUPAC name is (5S)-5-diethoxyphosphoryl-3-(phenylmethoxymethyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | (5S)-5-diethoxyphosphoryl-3-(phenylmethoxymethyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 132581718 |
| Molecular Formula | C15H22NO5P |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (5S)-5-diethoxyphosphoryl-3-(phenylmethoxymethyl)-4,5-dihydro-1,2-oxazole |
| SMILES | CCOP(=O)(OCC)[C@H]1CC(COCc2ccccc2)=NO1 |
| InChI | InChI=1S/C15H22NO5P/c1-3-19-22(17,20-4-2)15-10-14(16-21-15)12-18-11-13-8-6-5-7-9-13/h5-9,15H,3-4,10-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | WANCRHQZUCDLMG-HNNXBMFYSA-N |
| XLogP | 3.57 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|