C26H25NO2 — CID 11728700
(1S,2S,5R,6R)-2,3,5-tribenzyl-7-oxa-3-azabicyclo[4.1.0]heptan-4-one (PubChem CID 11728700) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is (1S,2S,5R,6R)-2,3,5-tribenzyl-7-oxa-3-azabicyclo[4.1.0]heptan-4-one.
| Compound Name | (1S,2S,5R,6R)-2,3,5-tribenzyl-7-oxa-3-azabicyclo[4.1.0]heptan-4-one |
|---|---|
| PubChem CID | 11728700 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | (1S,2S,5R,6R)-2,3,5-tribenzyl-7-oxa-3-azabicyclo[4.1.0]heptan-4-one |
| SMILES | O=C1[C@H](Cc2ccccc2)[C@H]2O[C@H]2[C@H](Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H25NO2/c28-26-22(16-19-10-4-1-5-11-19)24-25(29-24)23(17-20-12-6-2-7-13-20)27(26)18-21-14-8-3-9-15-21/h1-15,22-25H,16-18H2/t22-,23+,24-,25+/m1/s1 |
| InChIKey | SADKSMVEUJFKPL-RCTAOEEJSA-N |
| XLogP | 4.27 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|