C18H22N2O5 — CID 11302410
(1S,5Z,8S)-11-[(2,4-dimethoxyphenyl)methyl]-3-oxa-9,11-diazabicyclo[6.2.2]dodec-5-ene-10,12-dione (PubChem CID 11302410) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is (1S,5Z,8S)-11-[(2,4-dimethoxyphenyl)methyl]-3-oxa-9,11-diazabicyclo[6.2.2]dodec-5-ene-10,12-dione.
| Compound Name | (1S,5Z,8S)-11-[(2,4-dimethoxyphenyl)methyl]-3-oxa-9,11-diazabicyclo[6.2.2]dodec-5-ene-10,12-dione |
|---|---|
| PubChem CID | 11302410 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (1S,5Z,8S)-11-[(2,4-dimethoxyphenyl)methyl]-3-oxa-9,11-diazabicyclo[6.2.2]dodec-5-ene-10,12-dione |
| SMILES | COc1ccc(CN2C(=O)[C@@H]3C/C=C\COC[C@H]2C(=O)N3)c(OC)c1 |
| InChI | InChI=1S/C18H22N2O5/c1-23-13-7-6-12(16(9-13)24-2)10-20-15-11-25-8-4-3-5-14(18(20)22)19-17(15)21/h3-4,6-7,9,14-15H,5,8,10-11H2,1-2H3,(H,19,21)/b4-3-/t14-,15-/m0/s1 |
| InChIKey | WNYPEVYMUJOROL-CGXNLCPXSA-N |
| XLogP | 0.88 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|