About (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one
(5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one (PubChem CID 91919581) has the molecular formula C20H28N2O5
and a molecular weight of 376.45 g/mol. Its IUPAC name is (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one.
Molecular Properties
| Compound Name | (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one |
| PubChem CID | 91919581 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one |
| SMILES | COc1ccc(CN2C(=O)COC[C@H]2C(=O)N2CCC(C)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H28N2O5/c1-14-6-8-21(9-7-14)20(24)17-12-27-13-19(23)22(17)11-15-4-5-16(25-2)10-18(15)26-3/h4-5,10,14,17H,6-9,11-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | JOPAKEOQTBBJCG-KRWDZBQOSA-N |
| XLogP | 1.69 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one?
The IUPAC name of (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one (CID 91919581) is (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one.
What is the SMILES notation for (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one?
The canonical SMILES for (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one is COc1ccc(CN2C(=O)COC[C@H]2C(=O)N2CCC(C)CC2)c(OC)c1.
What is the InChIKey of (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one?
The InChIKey is JOPAKEOQTBBJCG-KRWDZBQOSA-N. The full InChI is InChI=1S/C20H28N2O5/c1-14-6-8-21(9-7-14)20(24)17-12-27-13-19(23)22(17)11-15-4-5-16(25-2)10-18(15)26-3/h4-5,10,14,17H,6-9,11-13H2,1-3H3/t17-/m0/s1.
What are the key properties of (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one?
(5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one has a molecular weight of 376.45 g/mol, XLogP of 1.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-4-[(2,4-dimethoxyphenyl)methyl]-5-(4-methylpiperidine-1-carbonyl)morpholin-3-one is sourced from PubChem (CID 91919581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).