C24H29Cl2N5O — CID 129153800
(3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-propan-2-yl-3-(2H-tetrazol-5-ylmethyl)piperidin-2-one (PubChem CID 129153800) has the molecular formula C24H29Cl2N5O and a molecular weight of 474.44 g/mol. Its IUPAC name is (3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-propan-2-yl-3-(2H-tetrazol-5-ylmethyl)piperidin-2-one.
| Compound Name | (3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-propan-2-yl-3-(2H-tetrazol-5-ylmethyl)piperidin-2-one |
|---|---|
| PubChem CID | 129153800 |
| Molecular Formula | C24H29Cl2N5O |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-propan-2-yl-3-(2H-tetrazol-5-ylmethyl)piperidin-2-one |
| SMILES | C=C(/C=C\C(Cl)=C/C)[C@@H]1[C@@H](c2cccc(Cl)c2)C[C@](C)(Cc2nn[nH]n2)C(=O)N1C(C)C |
| InChI | InChI=1S/C24H29Cl2N5O/c1-6-18(25)11-10-16(4)22-20(17-8-7-9-19(26)12-17)13-24(5,14-21-27-29-30-28-21)23(32)31(22)15(2)3/h6-12,15,20,22H,4,13-14H2,1-3,5H3,(H,27,28,29,30)/b11-10-,18-6+/t20-,22-,24-/m1/s1 |
| InChIKey | HTGHKLMGEOEZDO-GMQVXWHHSA-N |
| XLogP | 5.45 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|