C27H36Cl2N2O3 — CID 138642265
(2S)-3-[(3R,5R,6S)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]-2-hydroxypropanamide (PubChem CID 138642265) has the molecular formula C27H36Cl2N2O3 and a molecular weight of 507.50 g/mol. Its IUPAC name is (2S)-3-[(3R,5R,6S)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]-2-hydroxypropanamide.
| Compound Name | (2S)-3-[(3R,5R,6S)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 138642265 |
| Molecular Formula | C27H36Cl2N2O3 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (2S)-3-[(3R,5R,6S)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-1-pentan-3-ylpiperidin-3-yl]-2-hydroxypropanamide |
| SMILES | C=C(Cl)/C=C\C(=C/C)[C@@H]1[C@@H](c2cccc(Cl)c2)C[C@](C)(C[C@H](O)C(N)=O)C(=O)N1C(CC)CC |
| InChI | InChI=1S/C27H36Cl2N2O3/c1-6-18(13-12-17(4)28)24-22(19-10-9-11-20(29)14-19)15-27(5,16-23(32)25(30)33)26(34)31(24)21(7-2)8-3/h6,9-14,21-24,32H,4,7-8,15-16H2,1-3,5H3,(H2,30,33)/b13-12-,18-6+/t22-,23+,24-,27-/m1/s1 |
| InChIKey | PSUJJVIEILEXRB-ILTZPDPBSA-N |
| XLogP | 5.71 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|