C29H39Cl2NO5S — CID 129154002
2-[(3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-(3-methyl-1-propan-2-ylsulfonylbutan-2-yl)-2-oxopiperidin-3-yl]acetic acid (PubChem CID 129154002) has the molecular formula C29H39Cl2NO5S and a molecular weight of 584.61 g/mol. Its IUPAC name is 2-[(3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-(3-methyl-1-propan-2-ylsulfonylbutan-2-yl)-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-(3-methyl-1-propan-2-ylsulfonylbutan-2-yl)-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 129154002 |
| Molecular Formula | C29H39Cl2NO5S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | 2-[(3R,5R,6S)-6-[(3Z,5E)-5-chlorohepta-1,3,5-trien-2-yl]-5-(3-chlorophenyl)-3-methyl-1-(3-methyl-1-propan-2-ylsulfonylbutan-2-yl)-2-oxopiperidin-3-yl]acetic acid |
| SMILES | C=C(/C=C\C(Cl)=C/C)[C@@H]1[C@@H](c2cccc(Cl)c2)C[C@](C)(CC(=O)O)C(=O)N1C(CS(=O)(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C29H39Cl2NO5S/c1-8-22(30)13-12-20(6)27-24(21-10-9-11-23(31)14-21)15-29(7,16-26(33)34)28(35)32(27)25(18(2)3)17-38(36,37)19(4)5/h8-14,18-19,24-25,27H,6,15-17H2,1-5,7H3,(H,33,34)/b13-12-,22-8+/t24-,25?,27-,29-/m1/s1 |
| InChIKey | DCYKWKZKTVGCNG-HMNARIPOSA-N |
| XLogP | 6.61 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|