C30H40Cl2N2O3S — CID 138641975
N-[(2R)-3-[(3S,5R)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]pentan-2-yl]cyclopropanesulfonamide (PubChem CID 138641975) has the molecular formula C30H40Cl2N2O3S and a molecular weight of 579.63 g/mol. Its IUPAC name is N-[(2R)-3-[(3S,5R)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]pentan-2-yl]cyclopropanesulfonamide.
| Compound Name | N-[(2R)-3-[(3S,5R)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]pentan-2-yl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 138641975 |
| Molecular Formula | C30H40Cl2N2O3S |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | N-[(2R)-3-[(3S,5R)-6-[(2E,4Z)-6-chlorohepta-2,4,6-trien-3-yl]-5-(3-chlorophenyl)-3-methyl-2-oxo-3-prop-2-enylpiperidin-1-yl]pentan-2-yl]cyclopropanesulfonamide |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)C(C(/C=C\C(=C)Cl)=C/C)N(C(CC)[C@@H](C)NS(=O)(=O)C2CC2)C1=O |
| InChI | InChI=1S/C30H40Cl2N2O3S/c1-7-17-30(6)19-26(23-11-10-12-24(32)18-23)28(22(8-2)14-13-20(4)31)34(29(30)35)27(9-3)21(5)33-38(36,37)25-15-16-25/h7-8,10-14,18,21,25-28,33H,1,4,9,15-17,19H2,2-3,5-6H3/b14-13-,22-8+/t21-,26-,27?,28?,30+/m1/s1 |
| InChIKey | XWWPBICFDBRDML-VVTCXMEVSA-N |
| XLogP | 7.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|