C27H26Cl2N2O — CID 76834755
5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(4-methyl-2-pyridinyl)-3-prop-2-enylpiperidin-2-one (PubChem CID 76834755) has the molecular formula C27H26Cl2N2O and a molecular weight of 465.42 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(4-methyl-2-pyridinyl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(4-methyl-2-pyridinyl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 76834755 |
| Molecular Formula | C27H26Cl2N2O |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(4-methyl-2-pyridinyl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CCC1(C)CC(c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(c2cc(C)ccn2)C1=O |
| InChI | InChI=1S/C27H26Cl2N2O/c1-4-13-27(3)17-23(20-6-5-7-22(29)16-20)25(19-8-10-21(28)11-9-19)31(26(27)32)24-15-18(2)12-14-30-24/h4-12,14-16,23,25H,1,13,17H2,2-3H3 |
| InChIKey | HALAAYULTMUHOO-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|