C25H25Cl2N3O — CID 58573830
(3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-methylpyrazol-4-yl)-3-prop-2-enylpiperidin-2-one (PubChem CID 58573830) has the molecular formula C25H25Cl2N3O and a molecular weight of 454.40 g/mol. Its IUPAC name is (3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-methylpyrazol-4-yl)-3-prop-2-enylpiperidin-2-one.
| Compound Name | (3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-methylpyrazol-4-yl)-3-prop-2-enylpiperidin-2-one |
|---|---|
| PubChem CID | 58573830 |
| Molecular Formula | C25H25Cl2N3O |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (3S,5R)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-methyl-1-(1-methylpyrazol-4-yl)-3-prop-2-enylpiperidin-2-one |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(Cl)c2)C(c2ccc(Cl)cc2)N(c2cnn(C)c2)C1=O |
| InChI | InChI=1S/C25H25Cl2N3O/c1-4-12-25(2)14-22(18-6-5-7-20(27)13-18)23(17-8-10-19(26)11-9-17)30(24(25)31)21-15-28-29(3)16-21/h4-11,13,15-16,22-23H,1,12,14H2,2-3H3/t22-,23?,25+/m1/s1 |
| InChIKey | LOWKZYWCJPTRIM-XOTJBQCQSA-N |
| XLogP | 6.57 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|