C23H19Cl2N3O3 — CID 123304371
6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(1-methylpyrazol-4-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione (PubChem CID 123304371) has the molecular formula C23H19Cl2N3O3 and a molecular weight of 456.33 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(1-methylpyrazol-4-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione.
| Compound Name | 6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(1-methylpyrazol-4-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione |
|---|---|
| PubChem CID | 123304371 |
| Molecular Formula | C23H19Cl2N3O3 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(1-methylpyrazol-4-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione |
| SMILES | Cn1cc(N2C(=O)C3(CC(=O)O3)CC(c3cccc(Cl)c3)C2c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C23H19Cl2N3O3/c1-27-13-18(12-26-27)28-21(14-5-7-16(24)8-6-14)19(15-3-2-4-17(25)9-15)10-23(22(28)30)11-20(29)31-23/h2-9,12-13,19,21H,10-11H2,1H3 |
| InChIKey | JBDKKCZFMWUKSS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|