C27H28Cl2N2O3 — CID 123186528
4-[6-(3-chlorophenyl)-7-(4-chlorophenyl)-2,9-dioxo-1-oxa-8-azaspiro[3.5]nonan-8-yl]-2,2-dimethylhexanenitrile (PubChem CID 123186528) has the molecular formula C27H28Cl2N2O3 and a molecular weight of 499.44 g/mol. Its IUPAC name is 4-[6-(3-chlorophenyl)-7-(4-chlorophenyl)-2,9-dioxo-1-oxa-8-azaspiro[3.5]nonan-8-yl]-2,2-dimethylhexanenitrile.
| Compound Name | 4-[6-(3-chlorophenyl)-7-(4-chlorophenyl)-2,9-dioxo-1-oxa-8-azaspiro[3.5]nonan-8-yl]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 123186528 |
| Molecular Formula | C27H28Cl2N2O3 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 4-[6-(3-chlorophenyl)-7-(4-chlorophenyl)-2,9-dioxo-1-oxa-8-azaspiro[3.5]nonan-8-yl]-2,2-dimethylhexanenitrile |
| SMILES | CCC(CC(C)(C)C#N)N1C(=O)C2(CC(=O)O2)CC(c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H28Cl2N2O3/c1-4-21(13-26(2,3)16-30)31-24(17-8-10-19(28)11-9-17)22(18-6-5-7-20(29)12-18)14-27(25(31)33)15-23(32)34-27/h5-12,21-22,24H,4,13-15H2,1-3H3 |
| InChIKey | BDONCEQYMCIGIH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|