C25H24Cl2F3NO5 — CID 123758247
6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(6,6,6-trifluoro-5,5-dihydroxyhexan-3-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione (PubChem CID 123758247) has the molecular formula C25H24Cl2F3NO5 and a molecular weight of 546.37 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(6,6,6-trifluoro-5,5-dihydroxyhexan-3-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione.
| Compound Name | 6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(6,6,6-trifluoro-5,5-dihydroxyhexan-3-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione |
|---|---|
| PubChem CID | 123758247 |
| Molecular Formula | C25H24Cl2F3NO5 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 6-(3-chlorophenyl)-7-(4-chlorophenyl)-8-(6,6,6-trifluoro-5,5-dihydroxyhexan-3-yl)-1-oxa-8-azaspiro[3.5]nonane-2,9-dione |
| SMILES | CCC(CC(O)(O)C(F)(F)F)N1C(=O)C2(CC(=O)O2)CC(c2cccc(Cl)c2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24Cl2F3NO5/c1-2-18(11-24(34,35)25(28,29)30)31-21(14-6-8-16(26)9-7-14)19(15-4-3-5-17(27)10-15)12-23(22(31)33)13-20(32)36-23/h3-10,18-19,21,34-35H,2,11-13H2,1H3 |
| InChIKey | GVSFKNYTGIUBTJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|