C32H40Cl2N2O3 — CID 58573326
(4S)-4-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-oxopiperidin-1-yl]-2,2-dimethylhexanenitrile (PubChem CID 58573326) has the molecular formula C32H40Cl2N2O3 and a molecular weight of 571.59 g/mol. Its IUPAC name is (4S)-4-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-oxopiperidin-1-yl]-2,2-dimethylhexanenitrile.
| Compound Name | (4S)-4-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-oxopiperidin-1-yl]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 58573326 |
| Molecular Formula | C32H40Cl2N2O3 |
| Molecular Weight | 571.59 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | (4S)-4-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-oxopiperidin-1-yl]-2,2-dimethylhexanenitrile |
| SMILES | CC[C@@H](CC(C)(C)C#N)N1C(=O)[C@@](C)(CC2COC(C)(C)O2)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H40Cl2N2O3/c1-7-25(16-30(2,3)20-35)36-28(21-11-13-23(33)14-12-21)27(22-9-8-10-24(34)15-22)18-32(6,29(36)37)17-26-19-38-31(4,5)39-26/h8-15,25-28H,7,16-19H2,1-6H3/t25-,26?,27+,28+,32-/m0/s1 |
| InChIKey | QCOJBRZVOBNJDI-IUIUZUMBSA-N |
| XLogP | 8.32 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.59 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |