C21H23N3O4 — CID 138703313
1-[(2,4-dimethoxyphenyl)methyl]-N'-hydroxy-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-5-carboximidamide (PubChem CID 138703313) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-N'-hydroxy-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-5-carboximidamide.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-N'-hydroxy-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-5-carboximidamide |
|---|---|
| PubChem CID | 138703313 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-N'-hydroxy-2-oxo-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrole-5-carboximidamide |
| SMILES | COc1ccc(CN2C(=O)CC3Cc4c(/C(N)=N/O)cccc4C32)c(OC)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-27-14-7-6-12(18(10-14)28-2)11-24-19(25)9-13-8-17-15(20(13)24)4-3-5-16(17)21(22)23-26/h3-7,10,13,20,26H,8-9,11H2,1-2H3,(H2,22,23) |
| InChIKey | KEWGDKUBGPJIQF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|