C14H18N2O4 — CID 97032922
(3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 97032922) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97032922 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3R)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1ccc(CN2C[C@H](C(N)=O)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-19-11-4-3-9(12(6-11)20-2)7-16-8-10(14(15)18)5-13(16)17/h3-4,6,10H,5,7-8H2,1-2H3,(H2,15,18)/t10-/m1/s1 |
| InChIKey | IIQYBUHFIPGYKX-SNVBAGLBSA-N |
| XLogP | 0.54 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |