C25H27NO6 — CID 155164024
4-(4-benzyl-2-oxooxolane-3-carbonyl)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 155164024) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is 4-(4-benzyl-2-oxooxolane-3-carbonyl)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 4-(4-benzyl-2-oxooxolane-3-carbonyl)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155164024 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 4-(4-benzyl-2-oxooxolane-3-carbonyl)-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2CC(C(=O)C3C(=O)OCC3Cc3ccccc3)CC2=O)c(OC)c1 |
| InChI | InChI=1S/C25H27NO6/c1-30-20-9-8-17(21(12-20)31-2)13-26-14-18(11-22(26)27)24(28)23-19(15-32-25(23)29)10-16-6-4-3-5-7-16/h3-9,12,18-19,23H,10-11,13-15H2,1-2H3 |
| InChIKey | ORHGQJKGYWVXFT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|