C26H32N2O4 — CID 146118443
N-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-2-phenylacetamide (PubChem CID 146118443) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is N-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-2-phenylacetamide.
| Compound Name | N-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 146118443 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | N-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-2-phenylacetamide |
| SMILES | COc1ccc(CN2C(=O)C[C@H]3[C@H](CNC(=O)Cc4ccccc4)[C@@H](C)C[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C26H32N2O4/c1-17-11-23-21(22(17)15-27-25(29)12-18-7-5-4-6-8-18)14-26(30)28(23)16-19-9-10-20(31-2)13-24(19)32-3/h4-10,13,17,21-23H,11-12,14-16H2,1-3H3,(H,27,29)/t17-,21-,22+,23+/m0/s1 |
| InChIKey | GHTDKWRBSQNSEI-AIZKBTNYSA-N |
| XLogP | 3.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |