C26H33N3O5 — CID 146118461
1-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-3-(3-methoxyphenyl)urea (PubChem CID 146118461) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 146118461 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 1-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)NC[C@H]2[C@@H]3CC(=O)N(Cc4ccc(OC)cc4OC)[C@@H]3C[C@@H]2C)c1 |
| InChI | InChI=1S/C26H33N3O5/c1-16-10-23-21(22(16)14-27-26(31)28-18-6-5-7-19(11-18)32-2)13-25(30)29(23)15-17-8-9-20(33-3)12-24(17)34-4/h5-9,11-12,16,21-23H,10,13-15H2,1-4H3,(H2,27,28,31)/t16-,21-,22+,23+/m0/s1 |
| InChIKey | CAQDYLMYPXXCHT-SVCSISOJSA-N |
| XLogP | 3.91 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |