C22H30N2O7 — CID 146118473
2-[2-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methylamino]-2-oxoethoxy]acetic acid (PubChem CID 146118473) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2-[2-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 146118473 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[2-[[(3aS,4R,5S,6aR)-1-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-4-yl]methylamino]-2-oxoethoxy]acetic acid |
| SMILES | COc1ccc(CN2C(=O)C[C@H]3[C@H](CNC(=O)COCC(=O)O)[C@@H](C)C[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C22H30N2O7/c1-13-6-18-16(17(13)9-23-20(25)11-31-12-22(27)28)8-21(26)24(18)10-14-4-5-15(29-2)7-19(14)30-3/h4-5,7,13,16-18H,6,8-12H2,1-3H3,(H,23,25)(H,27,28)/t13-,16-,17+,18+/m0/s1 |
| InChIKey | KVUZCFIQAFKUCM-VIBAHUMZSA-N |
| XLogP | 1.29 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |