C25H29F3N2O — CID 133134453
(4aS,8aR)-6-[(2,5-dimethylphenyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133134453) has the molecular formula C25H29F3N2O and a molecular weight of 430.51 g/mol. Its IUPAC name is (4aS,8aR)-6-[(2,5-dimethylphenyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-6-[(2,5-dimethylphenyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133134453 |
| Molecular Formula | C25H29F3N2O |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (4aS,8aR)-6-[(2,5-dimethylphenyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1ccc(C)c(CN2CC[C@@H]3[C@@H](CCC(=O)N3Cc3ccc(C(F)(F)F)cc3)C2)c1 |
| InChI | InChI=1S/C25H29F3N2O/c1-17-3-4-18(2)21(13-17)16-29-12-11-23-20(15-29)7-10-24(31)30(23)14-19-5-8-22(9-6-19)25(26,27)28/h3-6,8-9,13,20,23H,7,10-12,14-16H2,1-2H3/t20-,23+/m0/s1 |
| InChIKey | XHGZWJQNAGIFBL-NZQKXSOJSA-N |
| XLogP | 5.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |