C29H26F4N2O2 — CID 42501142
(4aR,8aS)-6-[3-(4-fluorophenyl)benzoyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 42501142) has the molecular formula C29H26F4N2O2 and a molecular weight of 510.53 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-(4-fluorophenyl)benzoyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-[3-(4-fluorophenyl)benzoyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 42501142 |
| Molecular Formula | C29H26F4N2O2 |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (4aR,8aS)-6-[3-(4-fluorophenyl)benzoyl]-1-[[4-(trifluoromethyl)phenyl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(c1cccc(-c2ccc(F)cc2)c1)N1CC[C@H]2[C@H](CCC(=O)N2Cc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C29H26F4N2O2/c30-25-11-6-20(7-12-25)21-2-1-3-22(16-21)28(37)34-15-14-26-23(18-34)8-13-27(36)35(26)17-19-4-9-24(10-5-19)29(31,32)33/h1-7,9-12,16,23,26H,8,13-15,17-18H2/t23-,26+/m1/s1 |
| InChIKey | UMMHCOOZFIQFRG-BVAGGSTKSA-N |
| XLogP | 6.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |