C24H25FN2O4 — CID 26274530
(4aR,8aS)-6-(1,3-benzodioxole-5-carbonyl)-1-[2-(3-fluorophenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 26274530) has the molecular formula C24H25FN2O4 and a molecular weight of 424.47 g/mol. Its IUPAC name is (4aR,8aS)-6-(1,3-benzodioxole-5-carbonyl)-1-[2-(3-fluorophenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-(1,3-benzodioxole-5-carbonyl)-1-[2-(3-fluorophenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 26274530 |
| Molecular Formula | C24H25FN2O4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (4aR,8aS)-6-(1,3-benzodioxole-5-carbonyl)-1-[2-(3-fluorophenyl)ethyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(c1ccc2c(c1)OCO2)N1CC[C@H]2[C@H](CCC(=O)N2CCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H25FN2O4/c25-19-3-1-2-16(12-19)8-11-27-20-9-10-26(14-18(20)5-7-23(27)28)24(29)17-4-6-21-22(13-17)31-15-30-21/h1-4,6,12-13,18,20H,5,7-11,14-15H2/t18-,20+/m1/s1 |
| InChIKey | BYDWSLFSQXUBGV-QUCCMNQESA-N |
| XLogP | 3.25 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |