C23H23FN2O4 — CID 133116570
(4aS,8aR)-1-(1,3-benzodioxol-5-ylmethyl)-6-(3-fluorobenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133116570) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is (4aS,8aR)-1-(1,3-benzodioxol-5-ylmethyl)-6-(3-fluorobenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(1,3-benzodioxol-5-ylmethyl)-6-(3-fluorobenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133116570 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (4aS,8aR)-1-(1,3-benzodioxol-5-ylmethyl)-6-(3-fluorobenzoyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C(c1cccc(F)c1)N1CC[C@@H]2[C@@H](CCC(=O)N2Cc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C23H23FN2O4/c24-18-3-1-2-16(11-18)23(28)25-9-8-19-17(13-25)5-7-22(27)26(19)12-15-4-6-20-21(10-15)30-14-29-20/h1-4,6,10-11,17,19H,5,7-9,12-14H2/t17-,19+/m0/s1 |
| InChIKey | SARDQXSJGUFFQZ-PKOBYXMFSA-N |
| XLogP | 3.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |