C27H27ClN2O4 — CID 42362696
(4aR,8aS)-1-(1,3-benzodioxol-5-ylmethyl)-6-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 42362696) has the molecular formula C27H27ClN2O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is (4aR,8aS)-1-(1,3-benzodioxol-5-ylmethyl)-6-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-1-(1,3-benzodioxol-5-ylmethyl)-6-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 42362696 |
| Molecular Formula | C27H27ClN2O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | (4aR,8aS)-1-(1,3-benzodioxol-5-ylmethyl)-6-[[5-(4-chlorophenyl)furan-2-yl]methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CN(Cc3ccc(-c4ccc(Cl)cc4)o3)CC[C@@H]2N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H27ClN2O4/c28-21-5-2-19(3-6-21)24-9-7-22(34-24)16-29-12-11-23-20(15-29)4-10-27(31)30(23)14-18-1-8-25-26(13-18)33-17-32-25/h1-3,5-9,13,20,23H,4,10-12,14-17H2/t20-,23+/m1/s1 |
| InChIKey | IZZTZDIBTNAMOY-OFNKIYASSA-N |
| XLogP | 5.34 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |