C29H29FN2O3 — CID 42482578
(4aR,8aS)-6-[4-(3-fluorophenyl)benzoyl]-1-[(4-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 42482578) has the molecular formula C29H29FN2O3 and a molecular weight of 472.56 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-(3-fluorophenyl)benzoyl]-1-[(4-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-[4-(3-fluorophenyl)benzoyl]-1-[(4-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 42482578 |
| Molecular Formula | C29H29FN2O3 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (4aR,8aS)-6-[4-(3-fluorophenyl)benzoyl]-1-[(4-methoxyphenyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | COc1ccc(CN2C(=O)CC[C@@H]3CN(C(=O)c4ccc(-c5cccc(F)c5)cc4)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C29H29FN2O3/c1-35-26-12-5-20(6-13-26)18-32-27-15-16-31(19-24(27)11-14-28(32)33)29(34)22-9-7-21(8-10-22)23-3-2-4-25(30)17-23/h2-10,12-13,17,24,27H,11,14-16,18-19H2,1H3/t24-,27+/m1/s1 |
| InChIKey | JXEPBWQKQFVCKI-SQHAQQRYSA-N |
| XLogP | 5.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |