C22H27F3N2O3 — CID 56855701
1-[(4aR,8aR)-6-[3-(trifluoromethyl)benzoyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-methylpentane-1,2-dione (PubChem CID 56855701) has the molecular formula C22H27F3N2O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-[(4aR,8aR)-6-[3-(trifluoromethyl)benzoyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-methylpentane-1,2-dione.
| Compound Name | 1-[(4aR,8aR)-6-[3-(trifluoromethyl)benzoyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-methylpentane-1,2-dione |
|---|---|
| PubChem CID | 56855701 |
| Molecular Formula | C22H27F3N2O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 1-[(4aR,8aR)-6-[3-(trifluoromethyl)benzoyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-1-yl]-3-methylpentane-1,2-dione |
| SMILES | CCC(C)C(=O)C(=O)N1CCC[C@@H]2CN(C(=O)c3cccc(C(F)(F)F)c3)CC[C@H]21 |
| InChI | InChI=1S/C22H27F3N2O3/c1-3-14(2)19(28)21(30)27-10-5-7-16-13-26(11-9-18(16)27)20(29)15-6-4-8-17(12-15)22(23,24)25/h4,6,8,12,14,16,18H,3,5,7,9-11,13H2,1-2H3/t14?,16-,18-/m1/s1 |
| InChIKey | ZTHORBOTMVDPGJ-NBSGVIAVSA-N |
| XLogP | 3.77 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|