C19H19F3N4O2S — CID 126465971
[(4aR,8aR)-1-(thiadiazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 126465971) has the molecular formula C19H19F3N4O2S and a molecular weight of 424.45 g/mol. Its IUPAC name is [(4aR,8aR)-1-(thiadiazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(4aR,8aR)-1-(thiadiazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 126465971 |
| Molecular Formula | C19H19F3N4O2S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [(4aR,8aR)-1-(thiadiazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CC[C@@H]2[C@H](CCCN2C(=O)c2csnn2)C1 |
| InChI | InChI=1S/C19H19F3N4O2S/c20-19(21,22)14-5-1-3-12(9-14)17(27)25-8-6-16-13(10-25)4-2-7-26(16)18(28)15-11-29-24-23-15/h1,3,5,9,11,13,16H,2,4,6-8,10H2/t13-,16-/m1/s1 |
| InChIKey | RUVUCLDJUOAHSA-CZUORRHYSA-N |
| XLogP | 3.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |